About bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate
bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate (PubChem CID 146347020) has the molecular formula C56H36O6S
and a molecular weight of 836.96 g/mol. Its IUPAC name is bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate.
Molecular Properties
| Compound Name | bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate |
| PubChem CID | 146347020 |
| Molecular Formula | C56H36O6S |
| Molecular Weight | 836.96 g/mol |
| Exact Mass | 836.22 |
| IUPAC Name | bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate |
| SMILES | O=C(Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3-c3ccccc32)cc1)c1ccc(C(=O)Oc2ccc(C3(c4ccc(O)cc4)c4ccccc4-c4ccccc43)cc2)s1 |
| InChI | InChI=1S/C56H36O6S/c57-39-25-17-35(18-26-39)55(47-13-5-1-9-43(47)44-10-2-6-14-48(44)55)37-21-29-41(30-22-37)61-53(59)51-33-34-52(63-51)54(60)62-42-31-23-38(24-32-42)56(36-19-27-40(58)28-20-36)49-15-7-3-11-45(49)46-12-4-8-16-50(46)56/h1-34,57-58H |
| InChIKey | YZHPMQNDHLPVQT-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 836.96 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate?
The IUPAC name of bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate (CID 146347020) is bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate.
What is the SMILES notation for bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate?
The canonical SMILES for bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate is O=C(Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3-c3ccccc32)cc1)c1ccc(C(=O)Oc2ccc(C3(c4ccc(O)cc4)c4ccccc4-c4ccccc43)cc2)s1.
What is the InChIKey of bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate?
The InChIKey is YZHPMQNDHLPVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H36O6S/c57-39-25-17-35(18-26-39)55(47-13-5-1-9-43(47)44-10-2-6-14-48(44)55)37-21-29-41(30-22-37)61-53(59)51-33-34-52(63-51)54(60)62-42-31-23-38(24-32-42)56(36-19-27-40(58)28-20-36)49-15-7-3-11-45(49)46-12-4-8-16-50(46)56/h1-34,57-58H.
What are the key properties of bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate?
bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate has a molecular weight of 836.96 g/mol, XLogP of 12.32, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate is sourced from PubChem (CID 146347020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).