C37H28O5 — CID 59331100
[4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3,5-diacetylbenzoate (PubChem CID 59331100) has the molecular formula C37H28O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3,5-diacetylbenzoate.
| Compound Name | [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3,5-diacetylbenzoate |
|---|---|
| PubChem CID | 59331100 |
| Molecular Formula | C37H28O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3,5-diacetylbenzoate |
| SMILES | COc1ccc(C2(c3ccc(OC(=O)c4cc(C(C)=O)cc(C(C)=O)c4)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C37H28O5/c1-23(38)25-20-26(24(2)39)22-27(21-25)36(40)42-31-18-14-29(15-19-31)37(28-12-16-30(41-3)17-13-28)34-10-6-4-8-32(34)33-9-5-7-11-35(33)37/h4-22H,1-3H3 |
| InChIKey | XRKHQBKOZDVGIO-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|