About [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate
[4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate (PubChem CID 58943087) has the molecular formula C35H26O4
and a molecular weight of 510.59 g/mol. Its IUPAC name is [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate.
Molecular Properties
| Compound Name | [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate |
| PubChem CID | 58943087 |
| Molecular Formula | C35H26O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate |
| SMILES | COc1ccc(C2(c3ccc(OC(=O)c4cccc(C(C)=O)c4)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C35H26O4/c1-23(36)24-8-7-9-25(22-24)34(37)39-29-20-16-27(17-21-29)35(26-14-18-28(38-2)19-15-26)32-12-5-3-10-30(32)31-11-4-6-13-33(31)35/h3-22H,1-2H3 |
| InChIKey | XKQFNYANJPOAMV-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate?
The IUPAC name of [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate (CID 58943087) is [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate.
What is the SMILES notation for [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate?
The canonical SMILES for [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate is COc1ccc(C2(c3ccc(OC(=O)c4cccc(C(C)=O)c4)cc3)c3ccccc3-c3ccccc32)cc1.
What is the InChIKey of [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate?
The InChIKey is XKQFNYANJPOAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H26O4/c1-23(36)24-8-7-9-25(22-24)34(37)39-29-20-16-27(17-21-29)35(26-14-18-28(38-2)19-15-26)32-12-5-3-10-30(32)31-11-4-6-13-33(31)35/h3-22H,1-2H3.
What are the key properties of [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate?
[4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate has a molecular weight of 510.59 g/mol, XLogP of 7.48, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[9-(4-methoxyphenyl)fluoren-9-yl]phenyl] 3-acetylbenzoate is sourced from PubChem (CID 58943087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).