C43H36O4 — CID 58999425
[4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 6-acetylnaphthalene-2-carboxylate (PubChem CID 58999425) has the molecular formula C43H36O4 and a molecular weight of 616.76 g/mol. Its IUPAC name is [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 6-acetylnaphthalene-2-carboxylate.
| Compound Name | [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 6-acetylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58999425 |
| Molecular Formula | C43H36O4 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 6-acetylnaphthalene-2-carboxylate |
| SMILES | COc1c(C)cc(C2(c3cc(C)c(OC(=O)c4ccc5cc(C(C)=O)ccc5c4)c(C)c3)c3ccccc3-c3ccccc32)cc1C |
| InChI | InChI=1S/C43H36O4/c1-25-19-34(20-26(2)40(25)46-6)43(38-13-9-7-11-36(38)37-12-8-10-14-39(37)43)35-21-27(3)41(28(4)22-35)47-42(45)33-18-17-31-23-30(29(5)44)15-16-32(31)24-33/h7-24H,1-6H3 |
| InChIKey | BHTQXNYDSTUWLV-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|