C28H21NO2 — CID 123463090
4-[9-(4-acetylphenyl)fluoren-9-yl]benzamide (PubChem CID 123463090) has the molecular formula C28H21NO2 and a molecular weight of 403.48 g/mol. Its IUPAC name is 4-[9-(4-acetylphenyl)fluoren-9-yl]benzamide.
| Compound Name | 4-[9-(4-acetylphenyl)fluoren-9-yl]benzamide |
|---|---|
| PubChem CID | 123463090 |
| Molecular Formula | C28H21NO2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-[9-(4-acetylphenyl)fluoren-9-yl]benzamide |
| SMILES | CC(=O)c1ccc(C2(c3ccc(C(N)=O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C28H21NO2/c1-18(30)19-10-14-21(15-11-19)28(22-16-12-20(13-17-22)27(29)31)25-8-4-2-6-23(25)24-7-3-5-9-26(24)28/h2-17H,1H3,(H2,29,31) |
| InChIKey | MBNKWIWOPRETAD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |