C32H31O5Si- — CID 18175912
2,2-dimethyloxasilinane;[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] carbonate (PubChem CID 18175912) has the molecular formula C32H31O5Si- and a molecular weight of 523.68 g/mol. Its IUPAC name is 2,2-dimethyloxasilinane;[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] carbonate.
| Compound Name | 2,2-dimethyloxasilinane;[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 18175912 |
| Molecular Formula | C32H31O5Si- |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 2,2-dimethyloxasilinane;[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] carbonate |
| SMILES | C[Si]1(C)CCCCO1.O=C([O-])Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C26H18O4.C6H14OSi/c27-19-13-9-17(10-14-19)26(18-11-15-20(16-12-18)30-25(28)29)23-7-3-1-5-21(23)22-6-2-4-8-24(22)26;1-8(2)6-4-3-5-7-8/h1-16,27H,(H,28,29);3-6H2,1-2H3/p-1 |
| InChIKey | SFPPMONPHPHWBF-UHFFFAOYSA-M |
| XLogP | 6.48 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|