C57H38O5S — CID 157291601
2-O-[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] 5-O-[4-[9-(4-methylphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate (PubChem CID 157291601) has the molecular formula C57H38O5S and a molecular weight of 834.99 g/mol. Its IUPAC name is 2-O-[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] 5-O-[4-[9-(4-methylphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate.
| Compound Name | 2-O-[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] 5-O-[4-[9-(4-methylphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 157291601 |
| Molecular Formula | C57H38O5S |
| Molecular Weight | 834.99 g/mol |
| Exact Mass | 834.24 |
| IUPAC Name | 2-O-[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] 5-O-[4-[9-(4-methylphenyl)fluoren-9-yl]phenyl] thiophene-2,5-dicarboxylate |
| SMILES | Cc1ccc(C2(c3ccc(OC(=O)c4ccc(C(=O)Oc5ccc(C6(c7ccc(O)cc7)c7ccccc7-c7ccccc76)cc5)s4)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C57H38O5S/c1-36-18-20-37(21-19-36)56(48-14-6-2-10-44(48)45-11-3-7-15-49(45)56)39-24-30-42(31-25-39)61-54(59)52-34-35-53(63-52)55(60)62-43-32-26-40(27-33-43)57(38-22-28-41(58)29-23-38)50-16-8-4-12-46(50)47-13-5-9-17-51(47)57/h2-35,58H,1H3 |
| InChIKey | ASJYFVVLAAJPBP-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.99 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|