C60H45Bi3O12 — CID 172712848
[4-[[3,5-bis[bis(4-prop-2-enoyloxyphenyl)bismuthanyl]phenyl]-(4-prop-2-enoyloxyphenyl)bismuthanyl]phenyl] prop-2-enoate (PubChem CID 172712848) has the molecular formula C60H45Bi3O12 and a molecular weight of 1584.95 g/mol. Its IUPAC name is [4-[[3,5-bis[bis(4-prop-2-enoyloxyphenyl)bismuthanyl]phenyl]-(4-prop-2-enoyloxyphenyl)bismuthanyl]phenyl] prop-2-enoate.
| Compound Name | [4-[[3,5-bis[bis(4-prop-2-enoyloxyphenyl)bismuthanyl]phenyl]-(4-prop-2-enoyloxyphenyl)bismuthanyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 172712848 |
| Molecular Formula | C60H45Bi3O12 |
| Molecular Weight | 1584.95 g/mol |
| Exact Mass | 1584.23 |
| IUPAC Name | [4-[[3,5-bis[bis(4-prop-2-enoyloxyphenyl)bismuthanyl]phenyl]-(4-prop-2-enoyloxyphenyl)bismuthanyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc([Bi](c2ccc(OC(=O)C=C)cc2)c2cc([Bi](c3ccc(OC(=O)C=C)cc3)c3ccc(OC(=O)C=C)cc3)cc([Bi](c3ccc(OC(=O)C=C)cc3)c3ccc(OC(=O)C=C)cc3)c2)cc1 |
| InChI | InChI=1S/6C9H7O2.C6H3.3Bi/c6*1-2-9(10)11-8-6-4-3-5-7-8;1-2-4-6-5-3-1;;;/h6*2,4-7H,1H2;1,4-5H;;; |
| InChIKey | FLXJMFBQEIOHAJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1584.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|