About ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate
ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate (PubChem CID 145231583) has the molecular formula C22H35NOS
and a molecular weight of 361.60 g/mol. Its IUPAC name is ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate.
Molecular Properties
| Compound Name | ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate |
| PubChem CID | 145231583 |
| Molecular Formula | C22H35NOS |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate |
| SMILES | C#Cc1ccc(COCCCCC(=C)CS/C=N/C)cc1.CC.CC |
| InChI | InChI=1S/C18H23NOS.2C2H6/c1-4-17-8-10-18(11-9-17)13-20-12-6-5-7-16(2)14-21-15-19-3;2*1-2/h1,8-11,15H,2,5-7,12-14H2,3H3;2*1-2H3/b19-15+;; |
| InChIKey | CEHUGSFCSVJAOC-WTBAQZMLSA-N |
| XLogP | 6.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate?
The IUPAC name of ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate (CID 145231583) is ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate.
What is the SMILES notation for ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate?
The canonical SMILES for ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate is C#Cc1ccc(COCCCCC(=C)CS/C=N/C)cc1.CC.CC.
What is the InChIKey of ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate?
The InChIKey is CEHUGSFCSVJAOC-WTBAQZMLSA-N. The full InChI is InChI=1S/C18H23NOS.2C2H6/c1-4-17-8-10-18(11-9-17)13-20-12-6-5-7-16(2)14-21-15-19-3;2*1-2/h1,8-11,15H,2,5-7,12-14H2,3H3;2*1-2H3/b19-15+;;.
What are the key properties of ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate?
ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate has a molecular weight of 361.60 g/mol, XLogP of 6.35, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[6-[(4-ethynylphenyl)methoxy]-2-methylidenehexyl] N-methylmethanimidothioate is sourced from PubChem (CID 145231583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).