C16H17NO — CID 143140604
4-[[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]oxymethyl]benzonitrile (PubChem CID 143140604) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-[[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]oxymethyl]benzonitrile.
| Compound Name | 4-[[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 143140604 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-[[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]oxymethyl]benzonitrile |
| SMILES | C=C/C(=C\C(C)=C/C)OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H17NO/c1-4-13(3)10-16(5-2)18-12-15-8-6-14(11-17)7-9-15/h4-10H,2,12H2,1,3H3/b13-4-,16-10+ |
| InChIKey | ONVTZTCLDQKKLZ-FAXUQDOSSA-N |
| XLogP | 4.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|