About (4-cyanophenyl)methyl formate
(4-cyanophenyl)methyl formate (PubChem CID 18398424) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is (4-cyanophenyl)methyl formate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl formate |
| PubChem CID | 18398424 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | (4-cyanophenyl)methyl formate |
| SMILES | N#Cc1ccc(COC=O)cc1 |
| InChI | InChI=1S/C9H7NO2/c10-5-8-1-3-9(4-2-8)6-12-7-11/h1-4,7H,6H2 |
| InChIKey | KACIZXURVDQQCX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl)methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl formate?
The IUPAC name of (4-cyanophenyl)methyl formate (CID 18398424) is (4-cyanophenyl)methyl formate.
What is the SMILES notation for (4-cyanophenyl)methyl formate?
The canonical SMILES for (4-cyanophenyl)methyl formate is N#Cc1ccc(COC=O)cc1.
What is the InChIKey of (4-cyanophenyl)methyl formate?
The InChIKey is KACIZXURVDQQCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c10-5-8-1-3-9(4-2-8)6-12-7-11/h1-4,7H,6H2.
What are the key properties of (4-cyanophenyl)methyl formate?
(4-cyanophenyl)methyl formate has a molecular weight of 161.16 g/mol, XLogP of 1.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl formate is sourced from PubChem (CID 18398424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).