About (4-cyanophenyl)methyl 2-cyclopentylacetate
(4-cyanophenyl)methyl 2-cyclopentylacetate (PubChem CID 2405362) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-cyclopentylacetate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 2-cyclopentylacetate |
| PubChem CID | 2405362 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (4-cyanophenyl)methyl 2-cyclopentylacetate |
| SMILES | N#Cc1ccc(COC(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C15H17NO2/c16-10-13-5-7-14(8-6-13)11-18-15(17)9-12-3-1-2-4-12/h5-8,12H,1-4,9,11H2 |
| InChIKey | PMPBNTBLHKBVRZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-cyanophenyl)methyl 2-cyclopentylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 2-cyclopentylacetate?
The IUPAC name of (4-cyanophenyl)methyl 2-cyclopentylacetate (CID 2405362) is (4-cyanophenyl)methyl 2-cyclopentylacetate.
What is the SMILES notation for (4-cyanophenyl)methyl 2-cyclopentylacetate?
The canonical SMILES for (4-cyanophenyl)methyl 2-cyclopentylacetate is N#Cc1ccc(COC(=O)CC2CCCC2)cc1.
What is the InChIKey of (4-cyanophenyl)methyl 2-cyclopentylacetate?
The InChIKey is PMPBNTBLHKBVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2/c16-10-13-5-7-14(8-6-13)11-18-15(17)9-12-3-1-2-4-12/h5-8,12H,1-4,9,11H2.
What are the key properties of (4-cyanophenyl)methyl 2-cyclopentylacetate?
(4-cyanophenyl)methyl 2-cyclopentylacetate has a molecular weight of 243.31 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 2-cyclopentylacetate is sourced from PubChem (CID 2405362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).