About [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen
[4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen (PubChem CID 158556157) has the molecular formula C18H22O6
and a molecular weight of 334.37 g/mol. Its IUPAC name is [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen.
Molecular Properties
| Compound Name | [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen |
| PubChem CID | 158556157 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen |
| SMILES | O=COCc1ccc(COC=O)cc1.OCc1ccc(CO)cc1.[H][H] |
| InChI | InChI=1S/C10H10O4.C8H10O2.H2/c11-7-13-5-9-1-2-10(4-3-9)6-14-8-12;9-5-7-1-2-8(6-10)4-3-7;/h1-4,7-8H,5-6H2;1-4,9-10H,5-6H2;1H |
| InChIKey | HQHZICYXHQYHSJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen?
The IUPAC name of [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen (CID 158556157) is [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen.
What is the SMILES notation for [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen?
The canonical SMILES for [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen is O=COCc1ccc(COC=O)cc1.OCc1ccc(CO)cc1.[H][H].
What is the InChIKey of [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen?
The InChIKey is HQHZICYXHQYHSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4.C8H10O2.H2/c11-7-13-5-9-1-2-10(4-3-9)6-14-8-12;9-5-7-1-2-8(6-10)4-3-7;/h1-4,7-8H,5-6H2;1-4,9-10H,5-6H2;1H.
What are the key properties of [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen?
[4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen has a molecular weight of 334.37 g/mol, XLogP of 1.95, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(formyloxymethyl)phenyl]methyl formate;[4-(hydroxymethyl)phenyl]methanol;molecular hydrogen is sourced from PubChem (CID 158556157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).