C8H6F2O2 — CID 87852383
(3,4-difluorophenyl)methyl formate (PubChem CID 87852383) has the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. Its IUPAC name is (3,4-difluorophenyl)methyl formate.
| Compound Name | (3,4-difluorophenyl)methyl formate |
|---|---|
| PubChem CID | 87852383 |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | (3,4-difluorophenyl)methyl formate |
| SMILES | O=COCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H6F2O2/c9-7-2-1-6(3-8(7)10)4-12-5-11/h1-3,5H,4H2 |
| InChIKey | XSTHLUWEEGEODF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|