C9H9F2NO — CID 59571779
(E)-N-[(3,4-difluorophenyl)methoxy]ethanimine (PubChem CID 59571779) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is (E)-N-[(3,4-difluorophenyl)methoxy]ethanimine.
| Compound Name | (E)-N-[(3,4-difluorophenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 59571779 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (E)-N-[(3,4-difluorophenyl)methoxy]ethanimine |
| SMILES | C/C=N/OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H9F2NO/c1-2-12-13-6-7-3-4-8(10)9(11)5-7/h2-5H,6H2,1H3/b12-2+ |
| InChIKey | ZIVIYLPJTVNUHO-SWGQDTFXSA-N |
| XLogP | 2.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|