C7H7F2NO — CID 19876093
O-[(3,4-difluorophenyl)methyl]hydroxylamine (PubChem CID 19876093) has the molecular formula C7H7F2NO and a molecular weight of 159.13 g/mol. Its IUPAC name is O-[(3,4-difluorophenyl)methyl]hydroxylamine.
| Compound Name | O-[(3,4-difluorophenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 19876093 |
| Molecular Formula | C7H7F2NO |
| Molecular Weight | 159.13 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | O-[(3,4-difluorophenyl)methyl]hydroxylamine |
| SMILES | NOCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C7H7F2NO/c8-6-2-1-5(4-11-10)3-7(6)9/h1-3H,4,10H2 |
| InChIKey | JMDMKAAYVUMVCB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.13 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|