C24H22 — CID 174397877
1,1'-biphenyl;1-cyclopenta-1,3-dien-1-yl-3-methylbenzene (PubChem CID 174397877) has the molecular formula C24H22 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1,1'-biphenyl;1-cyclopenta-1,3-dien-1-yl-3-methylbenzene.
| Compound Name | 1,1'-biphenyl;1-cyclopenta-1,3-dien-1-yl-3-methylbenzene |
|---|---|
| PubChem CID | 174397877 |
| Molecular Formula | C24H22 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1,1'-biphenyl;1-cyclopenta-1,3-dien-1-yl-3-methylbenzene |
| SMILES | Cc1cccc(C2=CC=CC2)c1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H12.C12H10/c1-10-5-4-8-12(9-10)11-6-2-3-7-11;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h2-6,8-9H,7H2,1H3;1-10H |
| InChIKey | WKWYKUVMOFKSPJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |