C20H16 — CID 19892519
1,2-di(cyclopenta-1,3-dien-1-yl)naphthalene (PubChem CID 19892519) has the molecular formula C20H16 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1,2-di(cyclopenta-1,3-dien-1-yl)naphthalene.
| Compound Name | 1,2-di(cyclopenta-1,3-dien-1-yl)naphthalene |
|---|---|
| PubChem CID | 19892519 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1,2-di(cyclopenta-1,3-dien-1-yl)naphthalene |
| SMILES | C1=CCC(c2ccc3ccccc3c2C2=CC=CC2)=C1 |
| InChI | InChI=1S/C20H16/c1-2-8-15(7-1)19-14-13-16-9-5-6-12-18(16)20(19)17-10-3-4-11-17/h1-7,9-10,12-14H,8,11H2 |
| InChIKey | NGVZEFWGPNYBPA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |