C18H16 — CID 143924056
1-(4-methylcyclohepta-1,3,5-trien-1-yl)naphthalene (PubChem CID 143924056) has the molecular formula C18H16 and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(4-methylcyclohepta-1,3,5-trien-1-yl)naphthalene.
| Compound Name | 1-(4-methylcyclohepta-1,3,5-trien-1-yl)naphthalene |
|---|---|
| PubChem CID | 143924056 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-(4-methylcyclohepta-1,3,5-trien-1-yl)naphthalene |
| SMILES | CC1=CC=C(c2cccc3ccccc23)CC=C1 |
| InChI | InChI=1S/C18H16/c1-14-6-4-8-16(13-12-14)18-11-5-9-15-7-2-3-10-17(15)18/h2-7,9-13H,8H2,1H3 |
| InChIKey | ILABSGCAIQSIFH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |