C18H22O4 — CID 174976084
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;bis(2-methylprop-2-enoic acid) (PubChem CID 174976084) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;bis(2-methylprop-2-enoic acid).
| Compound Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 174976084 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;bis(2-methylprop-2-enoic acid) |
| SMILES | C1=CCC(C2=CC=CC2)=C1.C=C(C)C(=O)O.C=C(C)C(=O)O |
| InChI | InChI=1S/C10H10.2C4H6O2/c1-2-6-9(5-1)10-7-3-4-8-10;2*1-3(2)4(5)6/h1-5,7H,6,8H2;2*1H2,2H3,(H,5,6) |
| InChIKey | CVEOYXCGLXKUCO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|