C13H13N — CID 146278154
(5Z,7E,9Z,11Z)-1H-benzo[9]annulen-7-amine (PubChem CID 146278154) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is (5Z,7E,9Z,11Z)-1H-benzo[9]annulen-7-amine.
| Compound Name | (5Z,7E,9Z,11Z)-1H-benzo[9]annulen-7-amine |
|---|---|
| PubChem CID | 146278154 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (5Z,7E,9Z,11Z)-1H-benzo[9]annulen-7-amine |
| SMILES | NC1=C/C=C\C=C2\CC=CC=C2/C=C\1 |
| InChI | InChI=1S/C13H13N/c14-13-8-4-3-6-11-5-1-2-7-12(11)9-10-13/h1-4,6-10H,5,14H2/b4-3-,10-9-,11-6-,13-8+ |
| InChIKey | OBAUXSHVMOHNPW-XGPFWFEYSA-N |
| XLogP | 2.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |