C8H10N2 — CID 158390610
cycloocta-1,3,5,7-tetraene-1,5-diamine (PubChem CID 158390610) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is cycloocta-1,3,5,7-tetraene-1,5-diamine.
| Compound Name | cycloocta-1,3,5,7-tetraene-1,5-diamine |
|---|---|
| PubChem CID | 158390610 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | cycloocta-1,3,5,7-tetraene-1,5-diamine |
| SMILES | NC1=CC=CC(N)=CC=C1 |
| InChI | InChI=1S/C8H10N2/c9-7-3-1-4-8(10)6-2-5-7/h1-6H,9-10H2 |
| InChIKey | GWXMWAFOVBCXRS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |