C9H11N — CID 163991597
5,7-dimethylidenecyclohepta-1,3-dien-1-amine (PubChem CID 163991597) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 5,7-dimethylidenecyclohepta-1,3-dien-1-amine.
| Compound Name | 5,7-dimethylidenecyclohepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163991597 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 5,7-dimethylidenecyclohepta-1,3-dien-1-amine |
| SMILES | C=C1C=CC=C(N)C(=C)C1 |
| InChI | InChI=1S/C9H11N/c1-7-4-3-5-9(10)8(2)6-7/h3-5H,1-2,6,10H2 |
| InChIKey | UBCDKOMRXUCLEY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |