About methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate
methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate (PubChem CID 175387361) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate.
Analyze methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate (CID 175387361) is methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate is C=C1C=CC=C(C(=O)OC)C1.
What is the InChIKey of methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate?
The InChIKey is GBSVGFAVWNTEHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-7-4-3-5-8(6-7)9(10)11-2/h3-5H,1,6H2,2H3.
What are the key properties of methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate?
methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate has a molecular weight of 150.18 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methylidenecyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 175387361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).