About dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate
dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate (PubChem CID 20531473) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate.
Analyze dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate?
The IUPAC name of dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate (CID 20531473) is dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate?
The canonical SMILES for dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate is COC(=O)C1=CC=CC(OC)(C(=O)OC)C1.
What is the InChIKey of dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate?
The InChIKey is PRMBJTVISCMRNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5/c1-14-9(12)8-5-4-6-11(7-8,16-3)10(13)15-2/h4-6H,7H2,1-3H3.
What are the key properties of dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate?
dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate has a molecular weight of 226.23 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-methoxycyclohexa-3,5-diene-1,3-dicarboxylate is sourced from PubChem (CID 20531473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).