About methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate
methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate (PubChem CID 141150739) has the molecular formula C10H10BrNO2
and a molecular weight of 256.10 g/mol. Its IUPAC name is methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 141150739 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=CC(C#N)(CBr)C1 |
| InChI | InChI=1S/C10H10BrNO2/c1-14-9(13)8-3-2-4-10(5-8,6-11)7-12/h2-4H,5-6H2,1H3 |
| InChIKey | HZOAHZIHSUOKBS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate (CID 141150739) is methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=CC=CC(C#N)(CBr)C1.
What is the InChIKey of methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate?
The InChIKey is HZOAHZIHSUOKBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO2/c1-14-9(13)8-3-2-4-10(5-8,6-11)7-12/h2-4H,5-6H2,1H3.
What are the key properties of methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate?
methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate has a molecular weight of 256.10 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 141150739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).