C10H10BrNO2 — CID 141150739
methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate (PubChem CID 141150739) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 141150739 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | methyl 5-(bromomethyl)-5-cyanocyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=CC(C#N)(CBr)C1 |
| InChI | InChI=1S/C10H10BrNO2/c1-14-9(13)8-3-2-4-10(5-8,6-11)7-12/h2-4H,5-6H2,1H3 |
| InChIKey | HZOAHZIHSUOKBS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|