About ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate
ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 142945480) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate.
Analyze ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate (CID 142945480) is ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate is CC.COC(=O)C1=CC=C(C)CC1.
What is the InChIKey of ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is XGJISINYLODZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C2H6/c1-7-3-5-8(6-4-7)9(10)11-2;1-2/h3,5H,4,6H2,1-2H3;1-2H3.
What are the key properties of ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate?
ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 182.26 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 4-methylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 142945480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).