About (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate
(4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 163725356) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate.
Analyze (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate (CID 163725356) is (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate is CC1=CC=C(C(=O)OC2CCC(C)CC2)CC1.
What is the InChIKey of (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is KVBLBELFGMHJDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-11-3-7-13(8-4-11)15(16)17-14-9-5-12(2)6-10-14/h3,7,12,14H,4-6,8-10H2,1-2H3.
What are the key properties of (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate?
(4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 234.34 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexyl) 4-methylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 163725356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).