C11H16O — CID 143214940
1-(4-methylcyclohexa-1,3-dien-1-yl)butan-1-one (PubChem CID 143214940) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-(4-methylcyclohexa-1,3-dien-1-yl)butan-1-one.
| Compound Name | 1-(4-methylcyclohexa-1,3-dien-1-yl)butan-1-one |
|---|---|
| PubChem CID | 143214940 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 1-(4-methylcyclohexa-1,3-dien-1-yl)butan-1-one |
| SMILES | CCCC(=O)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C11H16O/c1-3-4-11(12)10-7-5-9(2)6-8-10/h5,7H,3-4,6,8H2,1-2H3 |
| InChIKey | AJXFDOTXQSVQKD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |