C9H11BrO — CID 123526771
2-bromo-1-(4-methylcyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 123526771) has the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. Its IUPAC name is 2-bromo-1-(4-methylcyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | 2-bromo-1-(4-methylcyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 123526771 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-bromo-1-(4-methylcyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | CC1=CC=C(C(=O)CBr)CC1 |
| InChI | InChI=1S/C9H11BrO/c1-7-2-4-8(5-3-7)9(11)6-10/h2,4H,3,5-6H2,1H3 |
| InChIKey | AXOWVTUXJNKIPF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|