C10H22N2 — CID 143366498
ethane;methanamine;4-methylcyclohexa-1,3-dien-1-amine (PubChem CID 143366498) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;methanamine;4-methylcyclohexa-1,3-dien-1-amine.
| Compound Name | ethane;methanamine;4-methylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143366498 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;methanamine;4-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CC.CC1=CC=C(N)CC1.CN |
| InChI | InChI=1S/C7H11N.C2H6.CH5N/c1-6-2-4-7(8)5-3-6;2*1-2/h2,4H,3,5,8H2,1H3;1-2H3;2H2,1H3 |
| InChIKey | FXCHYUSDWRPXAI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |