C9H15Cl — CID 143258352
1-chloro-4-methylcyclohexa-1,3-diene;ethane (PubChem CID 143258352) has the molecular formula C9H15Cl and a molecular weight of 158.67 g/mol. Its IUPAC name is 1-chloro-4-methylcyclohexa-1,3-diene;ethane.
| Compound Name | 1-chloro-4-methylcyclohexa-1,3-diene;ethane |
|---|---|
| PubChem CID | 143258352 |
| Molecular Formula | C9H15Cl |
| Molecular Weight | 158.67 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-chloro-4-methylcyclohexa-1,3-diene;ethane |
| SMILES | CC.CC1=CC=C(Cl)CC1 |
| InChI | InChI=1S/C7H9Cl.C2H6/c1-6-2-4-7(8)5-3-6;1-2/h2,4H,3,5H2,1H3;1-2H3 |
| InChIKey | YMUMDTRGSGNCEO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |