C8H14O — CID 142050116
methane;4-methylcyclohexa-1,3-dien-1-ol (PubChem CID 142050116) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is methane;4-methylcyclohexa-1,3-dien-1-ol.
| Compound Name | methane;4-methylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 142050116 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | methane;4-methylcyclohexa-1,3-dien-1-ol |
| SMILES | C.CC1=CC=C(O)CC1 |
| InChI | InChI=1S/C7H10O.CH4/c1-6-2-4-7(8)5-3-6;/h2,4,8H,3,5H2,1H3;1H4 |
| InChIKey | SQYNFSLDGANGCN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |