C6H8O — CID 72585144
4-methylcyclopenta-1,3-dien-1-ol (PubChem CID 72585144) has the molecular formula C6H8O and a molecular weight of 96.13 g/mol. Its IUPAC name is 4-methylcyclopenta-1,3-dien-1-ol.
| Compound Name | 4-methylcyclopenta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 72585144 |
| Molecular Formula | C6H8O |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.06 |
| IUPAC Name | 4-methylcyclopenta-1,3-dien-1-ol |
| SMILES | CC1=CC=C(O)C1 |
| InChI | InChI=1S/C6H8O/c1-5-2-3-6(7)4-5/h2-3,7H,4H2,1H3 |
| InChIKey | QYBCMCYDNLIGOR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |