C6H7F — CID 143604595
1-fluoro-4-methylcyclopenta-1,3-diene (PubChem CID 143604595) has the molecular formula C6H7F and a molecular weight of 98.12 g/mol. Its IUPAC name is 1-fluoro-4-methylcyclopenta-1,3-diene.
| Compound Name | 1-fluoro-4-methylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 143604595 |
| Molecular Formula | C6H7F |
| Molecular Weight | 98.12 g/mol |
| Exact Mass | 98.05 |
| IUPAC Name | 1-fluoro-4-methylcyclopenta-1,3-diene |
| SMILES | CC1=CC=C(F)C1 |
| InChI | InChI=1S/C6H7F/c1-5-2-3-6(7)4-5/h2-3H,4H2,1H3 |
| InChIKey | ZRURVCRONGZVOD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |