C16H30 — CID 143856298
(E)-but-2-ene;1-tert-butyl-4-methylcyclopenta-1,3-diene;ethane (PubChem CID 143856298) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is (E)-but-2-ene;1-tert-butyl-4-methylcyclopenta-1,3-diene;ethane.
| Compound Name | (E)-but-2-ene;1-tert-butyl-4-methylcyclopenta-1,3-diene;ethane |
|---|---|
| PubChem CID | 143856298 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | (E)-but-2-ene;1-tert-butyl-4-methylcyclopenta-1,3-diene;ethane |
| SMILES | C/C=C/C.CC.CC1=CC=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C10H16.C4H8.C2H6/c1-8-5-6-9(7-8)10(2,3)4;1-3-4-2;1-2/h5-6H,7H2,1-4H3;3-4H,1-2H3;1-2H3/b;4-3+; |
| InChIKey | OQHHZEFCSHSRJX-ITDJAWRYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|