C15H26 — CID 91230432
1,3-ditert-butyl-5-methylcyclohexa-1,4-diene (PubChem CID 91230432) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-methylcyclohexa-1,4-diene.
| Compound Name | 1,3-ditert-butyl-5-methylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 91230432 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1,3-ditert-butyl-5-methylcyclohexa-1,4-diene |
| SMILES | CC1=CC(C(C)(C)C)C=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H26/c1-11-8-12(14(2,3)4)10-13(9-11)15(5,6)7/h8,10,12H,9H2,1-7H3 |
| InChIKey | DDMCWDDGLQROQN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|