C21H33P — CID 15847611
bis(4-tert-butyl-2-methylcyclopenta-1,3-dien-1-yl)-methylphosphane (PubChem CID 15847611) has the molecular formula C21H33P and a molecular weight of 316.47 g/mol. Its IUPAC name is bis(4-tert-butyl-2-methylcyclopenta-1,3-dien-1-yl)-methylphosphane.
| Compound Name | bis(4-tert-butyl-2-methylcyclopenta-1,3-dien-1-yl)-methylphosphane |
|---|---|
| PubChem CID | 15847611 |
| Molecular Formula | C21H33P |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | bis(4-tert-butyl-2-methylcyclopenta-1,3-dien-1-yl)-methylphosphane |
| SMILES | CC1=C(P(C)C2=C(C)C=C(C(C)(C)C)C2)CC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C21H33P/c1-14-10-16(20(3,4)5)12-18(14)22(9)19-13-17(11-15(19)2)21(6,7)8/h10-11H,12-13H2,1-9H3 |
| InChIKey | BJMHPRJPFLSIOM-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|