About 2-tert-butyl-1H-indene;zirconium
2-tert-butyl-1H-indene;zirconium (PubChem CID 159357994) has the molecular formula C13H16Zr
and a molecular weight of 263.50 g/mol. Its IUPAC name is 2-tert-butyl-1H-indene;zirconium.
Molecular Properties
| Compound Name | 2-tert-butyl-1H-indene;zirconium |
| PubChem CID | 159357994 |
| Molecular Formula | C13H16Zr |
| Molecular Weight | 263.50 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2-tert-butyl-1H-indene;zirconium |
| SMILES | CC(C)(C)C1=Cc2ccccc2C1.[Zr] |
| InChI | InChI=1S/C13H16.Zr/c1-13(2,3)12-8-10-6-4-5-7-11(10)9-12;/h4-8H,9H2,1-3H3; |
| InChIKey | LIEAHLOUDPQMFZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-1H-indene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1H-indene;zirconium?
The IUPAC name of 2-tert-butyl-1H-indene;zirconium (CID 159357994) is 2-tert-butyl-1H-indene;zirconium.
What is the SMILES notation for 2-tert-butyl-1H-indene;zirconium?
The canonical SMILES for 2-tert-butyl-1H-indene;zirconium is CC(C)(C)C1=Cc2ccccc2C1.[Zr].
What is the InChIKey of 2-tert-butyl-1H-indene;zirconium?
The InChIKey is LIEAHLOUDPQMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16.Zr/c1-13(2,3)12-8-10-6-4-5-7-11(10)9-12;/h4-8H,9H2,1-3H3;.
What are the key properties of 2-tert-butyl-1H-indene;zirconium?
2-tert-butyl-1H-indene;zirconium has a molecular weight of 263.50 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1H-indene;zirconium is sourced from PubChem (CID 159357994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).