About 1H-inden-2-ylsilane
1H-inden-2-ylsilane (PubChem CID 137327560) has the molecular formula C9H10Si
and a molecular weight of 146.26 g/mol. Its IUPAC name is 1H-inden-2-ylsilane.
Molecular Properties
| Compound Name | 1H-inden-2-ylsilane |
| PubChem CID | 137327560 |
| Molecular Formula | C9H10Si |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1H-inden-2-ylsilane |
| SMILES | [SiH3]C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C9H10Si/c10-9-5-7-3-1-2-4-8(7)6-9/h1-5H,6H2,10H3 |
| InChIKey | XCVBJMIXLOTLRO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-2-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-2-ylsilane?
The IUPAC name of 1H-inden-2-ylsilane (CID 137327560) is 1H-inden-2-ylsilane.
What is the SMILES notation for 1H-inden-2-ylsilane?
The canonical SMILES for 1H-inden-2-ylsilane is [SiH3]C1=Cc2ccccc2C1.
What is the InChIKey of 1H-inden-2-ylsilane?
The InChIKey is XCVBJMIXLOTLRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Si/c10-9-5-7-3-1-2-4-8(7)6-9/h1-5H,6H2,10H3.
What are the key properties of 1H-inden-2-ylsilane?
1H-inden-2-ylsilane has a molecular weight of 146.26 g/mol, XLogP of 0.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-2-ylsilane is sourced from PubChem (CID 137327560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).