About dilithium;hydride;2-methyl-1H-indene
dilithium;hydride;2-methyl-1H-indene (PubChem CID 174389256) has the molecular formula C10H12Li2
and a molecular weight of 146.09 g/mol. Its IUPAC name is dilithium;hydride;2-methyl-1H-indene.
Molecular Properties
| Compound Name | dilithium;hydride;2-methyl-1H-indene |
| PubChem CID | 174389256 |
| Molecular Formula | C10H12Li2 |
| Molecular Weight | 146.09 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | dilithium;hydride;2-methyl-1H-indene |
| SMILES | CC1=Cc2ccccc2C1.[H-].[H-].[Li+].[Li+] |
| InChI | InChI=1S/C10H10.2Li.2H/c1-8-6-9-4-2-3-5-10(9)7-8;;;;/h2-6H,7H2,1H3;;;;/q;2*+1;2*-1 |
| InChIKey | RRFXVSAOZMLNOS-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.09 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dilithium;hydride;2-methyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;hydride;2-methyl-1H-indene?
The IUPAC name of dilithium;hydride;2-methyl-1H-indene (CID 174389256) is dilithium;hydride;2-methyl-1H-indene.
What is the SMILES notation for dilithium;hydride;2-methyl-1H-indene?
The canonical SMILES for dilithium;hydride;2-methyl-1H-indene is CC1=Cc2ccccc2C1.[H-].[H-].[Li+].[Li+].
What is the InChIKey of dilithium;hydride;2-methyl-1H-indene?
The InChIKey is RRFXVSAOZMLNOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.2Li.2H/c1-8-6-9-4-2-3-5-10(9)7-8;;;;/h2-6H,7H2,1H3;;;;/q;2*+1;2*-1.
What are the key properties of dilithium;hydride;2-methyl-1H-indene?
dilithium;hydride;2-methyl-1H-indene has a molecular weight of 146.09 g/mol, XLogP of -3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;hydride;2-methyl-1H-indene is sourced from PubChem (CID 174389256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).