About dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene
dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene (PubChem CID 161014735) has the molecular formula C20H21Cl2P
and a molecular weight of 363.27 g/mol. Its IUPAC name is dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene.
Molecular Properties
| Compound Name | dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene |
| PubChem CID | 161014735 |
| Molecular Formula | C20H21Cl2P |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene |
| SMILES | C.CC1=Cc2ccccc2C1.ClP(Cl)C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C10H10.C9H7Cl2P.CH4/c1-8-6-9-4-2-3-5-10(9)7-8;10-12(11)9-5-7-3-1-2-4-8(7)6-9;/h2-6H,7H2,1H3;1-5H,6H2;1H4 |
| InChIKey | TXORBJIDZHMNJO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene?
The IUPAC name of dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene (CID 161014735) is dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene.
What is the SMILES notation for dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene?
The canonical SMILES for dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene is C.CC1=Cc2ccccc2C1.ClP(Cl)C1=Cc2ccccc2C1.
What is the InChIKey of dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene?
The InChIKey is TXORBJIDZHMNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.C9H7Cl2P.CH4/c1-8-6-9-4-2-3-5-10(9)7-8;10-12(11)9-5-7-3-1-2-4-8(7)6-9;/h2-6H,7H2,1H3;1-5H,6H2;1H4.
What are the key properties of dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene?
dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene has a molecular weight of 363.27 g/mol, XLogP of 7.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(1H-inden-2-yl)phosphane;methane;2-methyl-1H-indene is sourced from PubChem (CID 161014735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).