About 2-methyl-1H-indene;titanium(3+);trichloride
2-methyl-1H-indene;titanium(3+);trichloride (PubChem CID 157408587) has the molecular formula C10H10Cl3Ti
and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-methyl-1H-indene;titanium(3+);trichloride.
Molecular Properties
| Compound Name | 2-methyl-1H-indene;titanium(3+);trichloride |
| PubChem CID | 157408587 |
| Molecular Formula | C10H10Cl3Ti |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 282.93 |
| IUPAC Name | 2-methyl-1H-indene;titanium(3+);trichloride |
| SMILES | CC1=Cc2ccccc2C1.[Cl-].[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C10H10.3ClH.Ti/c1-8-6-9-4-2-3-5-10(9)7-8;;;;/h2-6H,7H2,1H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | BOAAACFARVZGOT-UHFFFAOYSA-K |
| XLogP | -6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | -6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl-1H-indene;titanium(3+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-indene;titanium(3+);trichloride?
The IUPAC name of 2-methyl-1H-indene;titanium(3+);trichloride (CID 157408587) is 2-methyl-1H-indene;titanium(3+);trichloride.
What is the SMILES notation for 2-methyl-1H-indene;titanium(3+);trichloride?
The canonical SMILES for 2-methyl-1H-indene;titanium(3+);trichloride is CC1=Cc2ccccc2C1.[Cl-].[Cl-].[Cl-].[Ti+3].
What is the InChIKey of 2-methyl-1H-indene;titanium(3+);trichloride?
The InChIKey is BOAAACFARVZGOT-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H10.3ClH.Ti/c1-8-6-9-4-2-3-5-10(9)7-8;;;;/h2-6H,7H2,1H3;3*1H;/q;;;;+3/p-3.
What are the key properties of 2-methyl-1H-indene;titanium(3+);trichloride?
2-methyl-1H-indene;titanium(3+);trichloride has a molecular weight of 284.42 g/mol, XLogP of -6.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-indene;titanium(3+);trichloride is sourced from PubChem (CID 157408587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).