C14H14 — CID 12975727
2,6-dimethyl-1,7-dihydro-s-indacene (PubChem CID 12975727) has the molecular formula C14H14 and a molecular weight of 182.27 g/mol. Its IUPAC name is 2,6-dimethyl-1,7-dihydro-s-indacene.
| Compound Name | 2,6-dimethyl-1,7-dihydro-s-indacene |
|---|---|
| PubChem CID | 12975727 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2,6-dimethyl-1,7-dihydro-s-indacene |
| SMILES | CC1=Cc2cc3c(cc2C1)CC(C)=C3 |
| InChI | InChI=1S/C14H14/c1-9-3-11-7-13-5-10(2)6-14(13)8-12(11)4-9/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | OHZUIFXOKKIYPR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |