About 1H-inden-2-ol;titanium
1H-inden-2-ol;titanium (PubChem CID 174394573) has the molecular formula C9H8OTi
and a molecular weight of 180.03 g/mol. Its IUPAC name is 1H-inden-2-ol;titanium.
Molecular Properties
| Compound Name | 1H-inden-2-ol;titanium |
| PubChem CID | 174394573 |
| Molecular Formula | C9H8OTi |
| Molecular Weight | 180.03 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 1H-inden-2-ol;titanium |
| SMILES | OC1=Cc2ccccc2C1.[Ti] |
| InChI | InChI=1S/C9H8O.Ti/c10-9-5-7-3-1-2-4-8(7)6-9;/h1-5,10H,6H2; |
| InChIKey | NLQZEYTUFGMGIO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.03 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-inden-2-ol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-2-ol;titanium?
The IUPAC name of 1H-inden-2-ol;titanium (CID 174394573) is 1H-inden-2-ol;titanium.
What is the SMILES notation for 1H-inden-2-ol;titanium?
The canonical SMILES for 1H-inden-2-ol;titanium is OC1=Cc2ccccc2C1.[Ti].
What is the InChIKey of 1H-inden-2-ol;titanium?
The InChIKey is NLQZEYTUFGMGIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.Ti/c10-9-5-7-3-1-2-4-8(7)6-9;/h1-5,10H,6H2;.
What are the key properties of 1H-inden-2-ol;titanium?
1H-inden-2-ol;titanium has a molecular weight of 180.03 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-2-ol;titanium is sourced from PubChem (CID 174394573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).