C23H28Cl2Zr — CID 174234442
2-(3,5-ditert-butylphenyl)-1H-indene;dichlorozirconium (PubChem CID 174234442) has the molecular formula C23H28Cl2Zr and a molecular weight of 466.61 g/mol. Its IUPAC name is 2-(3,5-ditert-butylphenyl)-1H-indene;dichlorozirconium.
| Compound Name | 2-(3,5-ditert-butylphenyl)-1H-indene;dichlorozirconium |
|---|---|
| PubChem CID | 174234442 |
| Molecular Formula | C23H28Cl2Zr |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 2-(3,5-ditert-butylphenyl)-1H-indene;dichlorozirconium |
| SMILES | CC(C)(C)c1cc(C2=Cc3ccccc3C2)cc(C(C)(C)C)c1.Cl[Zr]Cl |
| InChI | InChI=1S/C23H28.2ClH.Zr/c1-22(2,3)20-13-19(14-21(15-20)23(4,5)6)18-11-16-9-7-8-10-17(16)12-18;;;/h7-11,13-15H,12H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KZNPMJKDAQZOPR-UHFFFAOYSA-L |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|