About tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane
tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane (PubChem CID 174434868) has the molecular formula C17H27Cl2OSiZr-
and a molecular weight of 437.62 g/mol. Its IUPAC name is tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane.
Molecular Properties
| Compound Name | tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane |
| PubChem CID | 174434868 |
| Molecular Formula | C17H27Cl2OSiZr- |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=Cc2ccccc2C1.Cl[Zr]Cl.[CH2-]C |
| InChI | InChI=1S/C15H22OSi.C2H5.2ClH.Zr/c1-15(2,3)17(4,5)16-14-10-12-8-6-7-9-13(12)11-14;1-2;;;/h6-10H,11H2,1-5H3;1H2,2H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | UTUWFSPJHWRNAH-UHFFFAOYSA-L |
| XLogP | 6.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane?
The IUPAC name of tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane (CID 174434868) is tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane.
What is the SMILES notation for tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane?
The canonical SMILES for tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane is CC(C)(C)[Si](C)(C)OC1=Cc2ccccc2C1.Cl[Zr]Cl.[CH2-]C.
What is the InChIKey of tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane?
The InChIKey is UTUWFSPJHWRNAH-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H22OSi.C2H5.2ClH.Zr/c1-15(2,3)17(4,5)16-14-10-12-8-6-7-9-13(12)11-14;1-2;;;/h6-10H,11H2,1-5H3;1H2,2H3;2*1H;/q;-1;;;+2/p-2.
What are the key properties of tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane?
tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane has a molecular weight of 437.62 g/mol, XLogP of 6.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(1H-inden-2-yloxy)-dimethylsilane;dichlorozirconium;ethane is sourced from PubChem (CID 174434868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).