C21H16Cl2Zr — CID 175286821
2,5-diphenyl-1H-indene;zirconium(2+);dichloride (PubChem CID 175286821) has the molecular formula C21H16Cl2Zr and a molecular weight of 430.49 g/mol. Its IUPAC name is 2,5-diphenyl-1H-indene;zirconium(2+);dichloride.
| Compound Name | 2,5-diphenyl-1H-indene;zirconium(2+);dichloride |
|---|---|
| PubChem CID | 175286821 |
| Molecular Formula | C21H16Cl2Zr |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 2,5-diphenyl-1H-indene;zirconium(2+);dichloride |
| SMILES | C1=C(c2ccccc2)Cc2ccc(-c3ccccc3)cc21.[Cl-].[Cl-].[Zr+2] |
| InChI | InChI=1S/C21H16.2ClH.Zr/c1-3-7-16(8-4-1)18-11-12-19-14-20(15-21(19)13-18)17-9-5-2-6-10-17;;;/h1-13,15H,14H2;2*1H;/q;;;+2/p-2 |
| InChIKey | DKPPWIFZRVMJCN-UHFFFAOYSA-L |
| XLogP | -0.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|