C17H17N — CID 86066545
3-(1H-inden-2-yl)-N,N-dimethylaniline (PubChem CID 86066545) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-(1H-inden-2-yl)-N,N-dimethylaniline.
| Compound Name | 3-(1H-inden-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 86066545 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-(1H-inden-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C2=Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C17H17N/c1-18(2)17-9-5-8-15(12-17)16-10-13-6-3-4-7-14(13)11-16/h3-10,12H,11H2,1-2H3 |
| InChIKey | KTNICAYVCKZBMH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|