C14H14FN — CID 173224461
3-(2-fluorophenyl)-N,N-dimethylaniline (PubChem CID 173224461) has the molecular formula C14H14FN and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N,N-dimethylaniline.
| Compound Name | 3-(2-fluorophenyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 173224461 |
| Molecular Formula | C14H14FN |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-(2-fluorophenyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(-c2ccccc2F)c1 |
| InChI | InChI=1S/C14H14FN/c1-16(2)12-7-5-6-11(10-12)13-8-3-4-9-14(13)15/h3-10H,1-2H3 |
| InChIKey | ORGCYZJBQANTPU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |